C19H15Cl2FN5O4S- — CID 134610572
3-[[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]amino]propane-1-sulfinate (PubChem CID 134610572) has the molecular formula C19H15Cl2FN5O4S- and a molecular weight of 499.33 g/mol. Its IUPAC name is 3-[[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]amino]propane-1-sulfinate.
| Compound Name | 3-[[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]amino]propane-1-sulfinate |
|---|---|
| PubChem CID | 134610572 |
| Molecular Formula | C19H15Cl2FN5O4S- |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 3-[[5-[[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]pyrimidin-2-yl]amino]propane-1-sulfinate |
| SMILES | O=C(Nc1cnc(NCCCS(=O)[O-])nc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C19H16Cl2FN5O4S/c20-12-2-3-13(21)16(22)15(12)17(28)10-6-14(24-7-10)18(29)27-11-8-25-19(26-9-11)23-4-1-5-32(30)31/h2-3,6-9,24H,1,4-5H2,(H,27,29)(H,30,31)(H,23,25,26)/p-1 |
| InChIKey | MLIIKZYCEMGJKF-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|