C24H24Cl2FN5O2 — CID 134610530
4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-[methyl-(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-1H-pyrrole-2-carboxamide (PubChem CID 134610530) has the molecular formula C24H24Cl2FN5O2 and a molecular weight of 504.39 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-[methyl-(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-[methyl-(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610530 |
| Molecular Formula | C24H24Cl2FN5O2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-[methyl-(1-methylpiperidin-4-yl)amino]-3-pyridinyl]-1H-pyrrole-2-carboxamide |
| SMILES | CN1CCC(N(C)c2ccc(NC(=O)c3cc(C(=O)c4c(Cl)ccc(Cl)c4F)c[nH]3)cn2)CC1 |
| InChI | InChI=1S/C24H24Cl2FN5O2/c1-31-9-7-16(8-10-31)32(2)20-6-3-15(13-29-20)30-24(34)19-11-14(12-28-19)23(33)21-17(25)4-5-18(26)22(21)27/h3-6,11-13,16,28H,7-10H2,1-2H3,(H,30,34) |
| InChIKey | LWNUSKPVZMKRBD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|