C20H14Cl2FN3O4 — CID 118958994
4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(oxetan-3-yloxy)-3-pyridinyl]-1H-pyrrole-2-carboxamide (PubChem CID 118958994) has the molecular formula C20H14Cl2FN3O4 and a molecular weight of 450.25 g/mol. Its IUPAC name is 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(oxetan-3-yloxy)-3-pyridinyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(oxetan-3-yloxy)-3-pyridinyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118958994 |
| Molecular Formula | C20H14Cl2FN3O4 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 4-(3,6-dichloro-2-fluorobenzoyl)-N-[6-(oxetan-3-yloxy)-3-pyridinyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC2COC2)nc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C20H14Cl2FN3O4/c21-13-2-3-14(22)18(23)17(13)19(27)10-5-15(24-6-10)20(28)26-11-1-4-16(25-7-11)30-12-8-29-9-12/h1-7,12,24H,8-9H2,(H,26,28) |
| InChIKey | VSQNAEKYBUSPKK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|