C17H20Cl2FNO2 — CID 157378975
1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]propan-1-one;ethane;methane (PubChem CID 157378975) has the molecular formula C17H20Cl2FNO2 and a molecular weight of 360.26 g/mol. Its IUPAC name is 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]propan-1-one;ethane;methane.
| Compound Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]propan-1-one;ethane;methane |
|---|---|
| PubChem CID | 157378975 |
| Molecular Formula | C17H20Cl2FNO2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]propan-1-one;ethane;methane |
| SMILES | C.CC.CCC(=O)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C14H10Cl2FNO2.C2H6.CH4/c1-2-11(19)10-5-7(6-18-10)14(20)12-8(15)3-4-9(16)13(12)17;1-2;/h3-6,18H,2H2,1H3;1-2H3;1H4 |
| InChIKey | BKQOZIWXFGPPCR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|