C24H22Cl2FN3O2 — CID 160798664
1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-[4-(piperazin-1-ylmethyl)phenyl]ethanone (PubChem CID 160798664) has the molecular formula C24H22Cl2FN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-[4-(piperazin-1-ylmethyl)phenyl]ethanone.
| Compound Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-[4-(piperazin-1-ylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 160798664 |
| Molecular Formula | C24H22Cl2FN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-[4-(piperazin-1-ylmethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(CN2CCNCC2)cc1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C24H22Cl2FN3O2/c25-18-5-6-19(26)23(27)22(18)24(32)17-12-20(29-13-17)21(31)11-15-1-3-16(4-2-15)14-30-9-7-28-8-10-30/h1-6,12-13,28-29H,7-11,14H2 |
| InChIKey | SCTSWNUTYZHLDM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|