About 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane
1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane (PubChem CID 158238493) has the molecular formula C19H17Cl2FN2O2
and a molecular weight of 395.26 g/mol. Its IUPAC name is 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane.
Molecular Properties
| Compound Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane |
| PubChem CID | 158238493 |
| Molecular Formula | C19H17Cl2FN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane |
| SMILES | CC.O=C(CC1=CCN=C1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1 |
| InChI | InChI=1S/C17H11Cl2FN2O2.C2H6/c18-11-1-2-12(19)16(20)15(11)17(24)10-6-13(22-8-10)14(23)5-9-3-4-21-7-9;1-2/h1-3,6-8,22H,4-5H2;1-2H3 |
| InChIKey | GFGMCRNZURMQQA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane?
The IUPAC name of 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane (CID 158238493) is 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane.
What is the SMILES notation for 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane?
The canonical SMILES for 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane is CC.O=C(CC1=CCN=C1)c1cc(C(=O)c2c(Cl)ccc(Cl)c2F)c[nH]1.
What is the InChIKey of 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane?
The InChIKey is GFGMCRNZURMQQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2FN2O2.C2H6/c18-11-1-2-12(19)16(20)15(11)17(24)10-6-13(22-8-10)14(23)5-9-3-4-21-7-9;1-2/h1-3,6-8,22H,4-5H2;1-2H3.
What are the key properties of 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane?
1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane has a molecular weight of 395.26 g/mol, XLogP of 5.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,6-dichloro-2-fluorobenzoyl)-1H-pyrrol-2-yl]-2-(2H-pyrrol-4-yl)ethanone;ethane is sourced from PubChem (CID 158238493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).