C18H13ClFN3O2 — CID 134610564
4-(2-chloro-6-fluoro-3-methylbenzoyl)-N-pyridin-3-yl-1H-pyrrole-2-carboxamide (PubChem CID 134610564) has the molecular formula C18H13ClFN3O2 and a molecular weight of 357.77 g/mol. Its IUPAC name is 4-(2-chloro-6-fluoro-3-methylbenzoyl)-N-pyridin-3-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(2-chloro-6-fluoro-3-methylbenzoyl)-N-pyridin-3-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134610564 |
| Molecular Formula | C18H13ClFN3O2 |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-(2-chloro-6-fluoro-3-methylbenzoyl)-N-pyridin-3-yl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(F)c(C(=O)c2c[nH]c(C(=O)Nc3cccnc3)c2)c1Cl |
| InChI | InChI=1S/C18H13ClFN3O2/c1-10-4-5-13(20)15(16(10)19)17(24)11-7-14(22-8-11)18(25)23-12-3-2-6-21-9-12/h2-9,22H,1H3,(H,23,25) |
| InChIKey | ZGLJOHSAVBJIPK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |