C17H13ClFN3O2 — CID 135135602
4-[(2-chloro-6-fluorophenyl)-hydroxymethyl]-N-pyridin-3-yl-1H-pyrrole-2-carboxamide (PubChem CID 135135602) has the molecular formula C17H13ClFN3O2 and a molecular weight of 345.76 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)-hydroxymethyl]-N-pyridin-3-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)-hydroxymethyl]-N-pyridin-3-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135135602 |
| Molecular Formula | C17H13ClFN3O2 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)-hydroxymethyl]-N-pyridin-3-yl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1cc(C(O)c2c(F)cccc2Cl)c[nH]1 |
| InChI | InChI=1S/C17H13ClFN3O2/c18-12-4-1-5-13(19)15(12)16(23)10-7-14(21-8-10)17(24)22-11-3-2-6-20-9-11/h1-9,16,21,23H,(H,22,24) |
| InChIKey | GDYATJBFCWMPNV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |