C21H19ClFN3O3 — CID 166213427
1-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-3-[3-(pyridin-3-ylmethoxy)phenyl]urea (PubChem CID 166213427) has the molecular formula C21H19ClFN3O3 and a molecular weight of 415.85 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-3-[3-(pyridin-3-ylmethoxy)phenyl]urea.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-3-[3-(pyridin-3-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166213427 |
| Molecular Formula | C21H19ClFN3O3 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-3-[3-(pyridin-3-ylmethoxy)phenyl]urea |
| SMILES | O=C(NCC(O)c1c(F)cccc1Cl)Nc1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C21H19ClFN3O3/c22-17-7-2-8-18(23)20(17)19(27)12-25-21(28)26-15-5-1-6-16(10-15)29-13-14-4-3-9-24-11-14/h1-11,19,27H,12-13H2,(H2,25,26,28) |
| InChIKey | HSGDBESXOWGYCI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |