C22H17N3S2 — CID 134612583
3-[(4-methylphenyl)disulfanyl]-5,6-diphenyl-1,2,4-triazine (PubChem CID 134612583) has the molecular formula C22H17N3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[(4-methylphenyl)disulfanyl]-5,6-diphenyl-1,2,4-triazine.
| Compound Name | 3-[(4-methylphenyl)disulfanyl]-5,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 134612583 |
| Molecular Formula | C22H17N3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[(4-methylphenyl)disulfanyl]-5,6-diphenyl-1,2,4-triazine |
| SMILES | Cc1ccc(SSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H17N3S2/c1-16-12-14-19(15-13-16)26-27-22-23-20(17-8-4-2-5-9-17)21(24-25-22)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | YXHIDQNGIFXOIM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|