C24H21N3OS — CID 7842661
3-[2-(3-methylphenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine (PubChem CID 7842661) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[2-(3-methylphenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine.
| Compound Name | 3-[2-(3-methylphenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 7842661 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-[2-(3-methylphenoxy)ethylsulfanyl]-5,6-diphenyl-1,2,4-triazine |
| SMILES | Cc1cccc(OCCSc2nnc(-c3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H21N3OS/c1-18-9-8-14-21(17-18)28-15-16-29-24-25-22(19-10-4-2-5-11-19)23(26-27-24)20-12-6-3-7-13-20/h2-14,17H,15-16H2,1H3 |
| InChIKey | OZLKLDOLJXKQLF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|