C11H8BrF5O — CID 134616458
1-bromo-3-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 134616458) has the molecular formula C11H8BrF5O and a molecular weight of 331.08 g/mol. Its IUPAC name is 1-bromo-3-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-bromo-3-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 134616458 |
| Molecular Formula | C11H8BrF5O |
| Molecular Weight | 331.08 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-bromo-3-[3-(difluoromethyl)-5-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | O=C(CBr)Cc1cc(C(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8BrF5O/c12-5-9(18)3-6-1-7(10(13)14)4-8(2-6)11(15,16)17/h1-2,4,10H,3,5H2 |
| InChIKey | JIWTWTFCNJGBTF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|