About 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene
1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene (PubChem CID 134617182) has the molecular formula C14H7BrCl3F3
and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene |
| PubChem CID | 134617182 |
| Molecular Formula | C14H7BrCl3F3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene |
| SMILES | FC(F)(F)c1ccc(-c2cc(Cl)cc(Cl)c2Cl)c(CBr)c1 |
| InChI | InChI=1S/C14H7BrCl3F3/c15-6-7-3-8(14(19,20)21)1-2-10(7)11-4-9(16)5-12(17)13(11)18/h1-5H,6H2 |
| InChIKey | PJPVQWOSNCTAAW-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene?
The IUPAC name of 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene (CID 134617182) is 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene.
What is the SMILES notation for 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene?
The canonical SMILES for 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene is FC(F)(F)c1ccc(-c2cc(Cl)cc(Cl)c2Cl)c(CBr)c1.
What is the InChIKey of 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene?
The InChIKey is PJPVQWOSNCTAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrCl3F3/c15-6-7-3-8(14(19,20)21)1-2-10(7)11-4-9(16)5-12(17)13(11)18/h1-5H,6H2.
What are the key properties of 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene?
1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene has a molecular weight of 418.47 g/mol, XLogP of 7.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene is sourced from PubChem (CID 134617182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).