C14H7BrCl3F3 — CID 134617183
1-[2-(bromomethyl)-6-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene (PubChem CID 134617183) has the molecular formula C14H7BrCl3F3 and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-6-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene.
| Compound Name | 1-[2-(bromomethyl)-6-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene |
|---|---|
| PubChem CID | 134617183 |
| Molecular Formula | C14H7BrCl3F3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | 1-[2-(bromomethyl)-6-(trifluoromethyl)phenyl]-2,3,5-trichlorobenzene |
| SMILES | FC(F)(F)c1cccc(CBr)c1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H7BrCl3F3/c15-6-7-2-1-3-10(14(19,20)21)12(7)9-4-8(16)5-11(17)13(9)18/h1-5H,6H2 |
| InChIKey | COUWLARUPIGQMI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|