C9H6ClF3N2O2S2 — CID 134618543
2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)benzenesulfonyl chloride (PubChem CID 134618543) has the molecular formula C9H6ClF3N2O2S2 and a molecular weight of 330.74 g/mol. Its IUPAC name is 2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)benzenesulfonyl chloride.
| Compound Name | 2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 134618543 |
| Molecular Formula | C9H6ClF3N2O2S2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 2-(aminomethyl)-4-cyano-3-(trifluoromethylsulfanyl)benzenesulfonyl chloride |
| SMILES | N#Cc1ccc(S(=O)(=O)Cl)c(CN)c1SC(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N2O2S2/c10-19(16,17)7-2-1-5(3-14)8(6(7)4-15)18-9(11,12)13/h1-2H,4,15H2 |
| InChIKey | JAAQIMCHFZBPNL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |