C10H7F3N2O2S — CID 134651829
3-(aminomethyl)-4-cyano-2-(trifluoromethylsulfanyl)benzoic acid (PubChem CID 134651829) has the molecular formula C10H7F3N2O2S and a molecular weight of 276.24 g/mol. Its IUPAC name is 3-(aminomethyl)-4-cyano-2-(trifluoromethylsulfanyl)benzoic acid.
| Compound Name | 3-(aminomethyl)-4-cyano-2-(trifluoromethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 134651829 |
| Molecular Formula | C10H7F3N2O2S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-(aminomethyl)-4-cyano-2-(trifluoromethylsulfanyl)benzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)c(SC(F)(F)F)c1CN |
| InChI | InChI=1S/C10H7F3N2O2S/c11-10(12,13)18-8-6(9(16)17)2-1-5(3-14)7(8)4-15/h1-2H,4,15H2,(H,16,17) |
| InChIKey | CQOLUURJSZMHOI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |