C10H5ClF3NO2S — CID 134626558
3-(chloromethyl)-6-cyano-2-(trifluoromethylsulfanyl)benzoic acid (PubChem CID 134626558) has the molecular formula C10H5ClF3NO2S and a molecular weight of 295.67 g/mol. Its IUPAC name is 3-(chloromethyl)-6-cyano-2-(trifluoromethylsulfanyl)benzoic acid.
| Compound Name | 3-(chloromethyl)-6-cyano-2-(trifluoromethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 134626558 |
| Molecular Formula | C10H5ClF3NO2S |
| Molecular Weight | 295.67 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 3-(chloromethyl)-6-cyano-2-(trifluoromethylsulfanyl)benzoic acid |
| SMILES | N#Cc1ccc(CCl)c(SC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H5ClF3NO2S/c11-3-5-1-2-6(4-15)7(9(16)17)8(5)18-10(12,13)14/h1-2H,3H2,(H,16,17) |
| InChIKey | KZIFGQQXVCDSIY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|