C11H7ClF3NO2S — CID 134629963
2-[5-(chloromethyl)-4-cyano-2-(trifluoromethylsulfanyl)phenyl]acetic acid (PubChem CID 134629963) has the molecular formula C11H7ClF3NO2S and a molecular weight of 309.70 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-4-cyano-2-(trifluoromethylsulfanyl)phenyl]acetic acid.
| Compound Name | 2-[5-(chloromethyl)-4-cyano-2-(trifluoromethylsulfanyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134629963 |
| Molecular Formula | C11H7ClF3NO2S |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-[5-(chloromethyl)-4-cyano-2-(trifluoromethylsulfanyl)phenyl]acetic acid |
| SMILES | N#Cc1cc(SC(F)(F)F)c(CC(=O)O)cc1CCl |
| InChI | InChI=1S/C11H7ClF3NO2S/c12-4-7-1-6(3-10(17)18)9(2-8(7)5-16)19-11(13,14)15/h1-2H,3-4H2,(H,17,18) |
| InChIKey | GCIDOEZZFAMFAV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|