C15H8Cl4O2 — CID 134627731
(Z)-3-[5-chloro-2-(2,3,6-trichlorophenyl)phenyl]prop-2-enoic acid (PubChem CID 134627731) has the molecular formula C15H8Cl4O2 and a molecular weight of 362.04 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-(2,3,6-trichlorophenyl)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[5-chloro-2-(2,3,6-trichlorophenyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134627731 |
| Molecular Formula | C15H8Cl4O2 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | (Z)-3-[5-chloro-2-(2,3,6-trichlorophenyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C\c1cc(Cl)ccc1-c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C15H8Cl4O2/c16-9-2-3-10(8(7-9)1-6-13(20)21)14-11(17)4-5-12(18)15(14)19/h1-7H,(H,20,21)/b6-1- |
| InChIKey | XEQPKXDZZKGTRN-BHQIHCQQSA-N |
| XLogP | 6.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|