About 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride
3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride (PubChem CID 134628961) has the molecular formula C13H6ClF3O
and a molecular weight of 270.64 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride.
Molecular Properties
| Compound Name | 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride |
| PubChem CID | 134628961 |
| Molecular Formula | C13H6ClF3O |
| Molecular Weight | 270.64 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride |
| SMILES | O=C(Cl)c1cc(F)cc(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C13H6ClF3O/c14-13(18)8-4-7(5-9(15)6-8)10-2-1-3-11(16)12(10)17/h1-6H |
| InChIKey | LJMLNSVCIYGWJM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride?
The IUPAC name of 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride (CID 134628961) is 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride.
What is the SMILES notation for 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride?
The canonical SMILES for 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride is O=C(Cl)c1cc(F)cc(-c2cccc(F)c2F)c1.
What is the InChIKey of 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride?
The InChIKey is LJMLNSVCIYGWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClF3O/c14-13(18)8-4-7(5-9(15)6-8)10-2-1-3-11(16)12(10)17/h1-6H.
What are the key properties of 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride?
3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride has a molecular weight of 270.64 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenyl)-5-fluorobenzoyl chloride is sourced from PubChem (CID 134628961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).