C17H8Cl6N2 — CID 134629217
5,6-bis(2,3,4-trichlorophenyl)pyridin-3-amine (PubChem CID 134629217) has the molecular formula C17H8Cl6N2 and a molecular weight of 452.98 g/mol. Its IUPAC name is 5,6-bis(2,3,4-trichlorophenyl)pyridin-3-amine.
| Compound Name | 5,6-bis(2,3,4-trichlorophenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 134629217 |
| Molecular Formula | C17H8Cl6N2 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 449.88 |
| IUPAC Name | 5,6-bis(2,3,4-trichlorophenyl)pyridin-3-amine |
| SMILES | Nc1cnc(-c2ccc(Cl)c(Cl)c2Cl)c(-c2ccc(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H8Cl6N2/c18-11-3-1-8(13(20)15(11)22)10-5-7(24)6-25-17(10)9-2-4-12(19)16(23)14(9)21/h1-6H,24H2 |
| InChIKey | DRVMMLVDWBDQOZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|