C11H6Cl3IN2 — CID 119017203
3-iodo-5-(2,3,4-trichlorophenyl)pyridin-2-amine (PubChem CID 119017203) has the molecular formula C11H6Cl3IN2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-iodo-5-(2,3,4-trichlorophenyl)pyridin-2-amine.
| Compound Name | 3-iodo-5-(2,3,4-trichlorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119017203 |
| Molecular Formula | C11H6Cl3IN2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 397.86 |
| IUPAC Name | 3-iodo-5-(2,3,4-trichlorophenyl)pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(Cl)c(Cl)c2Cl)cc1I |
| InChI | InChI=1S/C11H6Cl3IN2/c12-7-2-1-6(9(13)10(7)14)5-3-8(15)11(16)17-4-5/h1-4H,(H2,16,17) |
| InChIKey | WTNAQLOHRGRLLG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|