C10H5Cl3N2O — CID 174358567
4-(2,3,4-trichlorophenyl)-1H-pyridazin-6-one (PubChem CID 174358567) has the molecular formula C10H5Cl3N2O and a molecular weight of 275.52 g/mol. Its IUPAC name is 4-(2,3,4-trichlorophenyl)-1H-pyridazin-6-one.
| Compound Name | 4-(2,3,4-trichlorophenyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 174358567 |
| Molecular Formula | C10H5Cl3N2O |
| Molecular Weight | 275.52 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | 4-(2,3,4-trichlorophenyl)-1H-pyridazin-6-one |
| SMILES | O=c1cc(-c2ccc(Cl)c(Cl)c2Cl)cn[nH]1 |
| InChI | InChI=1S/C10H5Cl3N2O/c11-7-2-1-6(9(12)10(7)13)5-3-8(16)15-14-4-5/h1-4H,(H,15,16) |
| InChIKey | IBCVDLNKPUXLMN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|