C12H6Cl3N3 — CID 134629287
5-amino-6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile (PubChem CID 134629287) has the molecular formula C12H6Cl3N3 and a molecular weight of 298.56 g/mol. Its IUPAC name is 5-amino-6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile.
| Compound Name | 5-amino-6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134629287 |
| Molecular Formula | C12H6Cl3N3 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 5-amino-6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N)c(-c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H6Cl3N3/c13-6-3-8(14)11(9(15)4-6)12-10(17)2-1-7(5-16)18-12/h1-4H,17H2 |
| InChIKey | CJADHTWJKWBWEK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |