C12H5Cl3N2 — CID 134636792
6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile (PubChem CID 134636792) has the molecular formula C12H5Cl3N2 and a molecular weight of 283.55 g/mol. Its IUPAC name is 6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile.
| Compound Name | 6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 134636792 |
| Molecular Formula | C12H5Cl3N2 |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 6-(2,4,6-trichlorophenyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(-c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H5Cl3N2/c13-7-4-9(14)12(10(15)5-7)11-3-1-2-8(6-16)17-11/h1-5H |
| InChIKey | GIAGIFXLUCBROD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |