C11H5Cl3IN — CID 134636340
2-iodo-6-(2,4,6-trichlorophenyl)pyridine (PubChem CID 134636340) has the molecular formula C11H5Cl3IN and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-iodo-6-(2,4,6-trichlorophenyl)pyridine.
| Compound Name | 2-iodo-6-(2,4,6-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134636340 |
| Molecular Formula | C11H5Cl3IN |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 382.85 |
| IUPAC Name | 2-iodo-6-(2,4,6-trichlorophenyl)pyridine |
| SMILES | Clc1cc(Cl)c(-c2cccc(I)n2)c(Cl)c1 |
| InChI | InChI=1S/C11H5Cl3IN/c12-6-4-7(13)11(8(14)5-6)9-2-1-3-10(15)16-9/h1-5H |
| InChIKey | NDJNJAGUJUBRQF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|