C14H8BrCl2F3 — CID 134629422
1-[5-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,4-dichlorobenzene (PubChem CID 134629422) has the molecular formula C14H8BrCl2F3 and a molecular weight of 384.02 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,4-dichlorobenzene.
| Compound Name | 1-[5-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 134629422 |
| Molecular Formula | C14H8BrCl2F3 |
| Molecular Weight | 384.02 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | 1-[5-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,4-dichlorobenzene |
| SMILES | FC(F)(F)c1ccc(CBr)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BrCl2F3/c15-7-8-1-4-12(14(18,19)20)11(5-8)10-3-2-9(16)6-13(10)17/h1-6H,7H2 |
| InChIKey | YPIUDDOKLNVKOL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.02 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|