C13H7BrCl3F — CID 134628714
5-[5-(bromomethyl)-2-fluorophenyl]-1,2,3-trichlorobenzene (PubChem CID 134628714) has the molecular formula C13H7BrCl3F and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[5-(bromomethyl)-2-fluorophenyl]-1,2,3-trichlorobenzene.
| Compound Name | 5-[5-(bromomethyl)-2-fluorophenyl]-1,2,3-trichlorobenzene |
|---|---|
| PubChem CID | 134628714 |
| Molecular Formula | C13H7BrCl3F |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 365.88 |
| IUPAC Name | 5-[5-(bromomethyl)-2-fluorophenyl]-1,2,3-trichlorobenzene |
| SMILES | Fc1ccc(CBr)cc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrCl3F/c14-6-7-1-2-12(18)9(3-7)8-4-10(15)13(17)11(16)5-8/h1-5H,6H2 |
| InChIKey | HHOWZIMTWGBFGG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|