C13H10Cl2FN — CID 134631440
[3-(2,4-dichlorophenyl)-5-fluorophenyl]methanamine (PubChem CID 134631440) has the molecular formula C13H10Cl2FN and a molecular weight of 270.13 g/mol. Its IUPAC name is [3-(2,4-dichlorophenyl)-5-fluorophenyl]methanamine.
| Compound Name | [3-(2,4-dichlorophenyl)-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 134631440 |
| Molecular Formula | C13H10Cl2FN |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | [3-(2,4-dichlorophenyl)-5-fluorophenyl]methanamine |
| SMILES | NCc1cc(F)cc(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl2FN/c14-10-1-2-12(13(15)6-10)9-3-8(7-17)4-11(16)5-9/h1-6H,7,17H2 |
| InChIKey | CTASGWZDMFHKNP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |