C12H5Cl4NO2 — CID 134637342
6-chloro-3-(2,3,5-trichlorophenyl)pyridine-2-carboxylic acid (PubChem CID 134637342) has the molecular formula C12H5Cl4NO2 and a molecular weight of 336.99 g/mol. Its IUPAC name is 6-chloro-3-(2,3,5-trichlorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-(2,3,5-trichlorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134637342 |
| Molecular Formula | C12H5Cl4NO2 |
| Molecular Weight | 336.99 g/mol |
| Exact Mass | 334.91 |
| IUPAC Name | 6-chloro-3-(2,3,5-trichlorophenyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)ccc1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H5Cl4NO2/c13-5-3-7(10(16)8(14)4-5)6-1-2-9(15)17-11(6)12(18)19/h1-4H,(H,18,19) |
| InChIKey | KLGPCQLQCFWTPF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|