C11H8Cl2N2O2 — CID 137368232
3,6-dichloropyridine-2-carboxylic acid;pyridine (PubChem CID 137368232) has the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 3,6-dichloropyridine-2-carboxylic acid;pyridine.
| Compound Name | 3,6-dichloropyridine-2-carboxylic acid;pyridine |
|---|---|
| PubChem CID | 137368232 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 3,6-dichloropyridine-2-carboxylic acid;pyridine |
| SMILES | O=C(O)c1nc(Cl)ccc1Cl.c1ccncc1 |
| InChI | InChI=1S/C6H3Cl2NO2.C5H5N/c7-3-1-2-4(8)9-5(3)6(10)11;1-2-4-6-5-3-1/h1-2H,(H,10,11);1-5H |
| InChIKey | BXCZYYNSPUHPRP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|