C12H8Cl2N2O2 — CID 133087067
6-amino-3-(2,6-dichlorophenyl)pyridine-2-carboxylic acid (PubChem CID 133087067) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is 6-amino-3-(2,6-dichlorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-amino-3-(2,6-dichlorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 133087067 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 6-amino-3-(2,6-dichlorophenyl)pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(-c2c(Cl)cccc2Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-7-2-1-3-8(14)10(7)6-4-5-9(15)16-11(6)12(17)18/h1-5H,(H2,15,16)(H,17,18) |
| InChIKey | ACAHZYFSFLYOGO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |