C11H9F3O3 — CID 134650054
(E)-3-[2-methyl-3-(trifluoromethoxy)phenyl]prop-2-enoic acid (PubChem CID 134650054) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is (E)-3-[2-methyl-3-(trifluoromethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-methyl-3-(trifluoromethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134650054 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (E)-3-[2-methyl-3-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1c(/C=C/C(=O)O)cccc1OC(F)(F)F |
| InChI | InChI=1S/C11H9F3O3/c1-7-8(5-6-10(15)16)3-2-4-9(7)17-11(12,13)14/h2-6H,1H3,(H,15,16)/b6-5+ |
| InChIKey | IWKYZPANUJOFGI-AATRIKPKSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|