C10H8F2N2O2 — CID 134651869
3-(aminomethyl)-2-cyano-6-(difluoromethyl)benzoic acid (PubChem CID 134651869) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 3-(aminomethyl)-2-cyano-6-(difluoromethyl)benzoic acid.
| Compound Name | 3-(aminomethyl)-2-cyano-6-(difluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 134651869 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-(aminomethyl)-2-cyano-6-(difluoromethyl)benzoic acid |
| SMILES | N#Cc1c(CN)ccc(C(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H8F2N2O2/c11-9(12)6-2-1-5(3-13)7(4-14)8(6)10(15)16/h1-2,9H,3,13H2,(H,15,16) |
| InChIKey | SFKBJRJJKMXRFB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |