C16H28O2 — CID 13465303
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-hex-2-enoate (PubChem CID 13465303) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-hex-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-hex-2-enoate |
|---|---|
| PubChem CID | 13465303 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-hex-2-enoate |
| SMILES | CCC/C=C/C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C16H28O2/c1-5-6-7-8-16(17)18-15-11-13(4)9-10-14(15)12(2)3/h7-8,12-15H,5-6,9-11H2,1-4H3/b8-7+/t13-,14+,15-/m1/s1 |
| InChIKey | SOJVECUWFLXECP-QFSCCXLESA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|