C11H12O5 — CID 134657253
2-hydroxy-2-[3-hydroxy-5-(3-oxopropyl)phenyl]acetic acid (PubChem CID 134657253) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-hydroxy-2-[3-hydroxy-5-(3-oxopropyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-hydroxy-5-(3-oxopropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134657253 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-hydroxy-2-[3-hydroxy-5-(3-oxopropyl)phenyl]acetic acid |
| SMILES | O=CCCc1cc(O)cc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H12O5/c12-3-1-2-7-4-8(6-9(13)5-7)10(14)11(15)16/h3-6,10,13-14H,1-2H2,(H,15,16) |
| InChIKey | CNFNCSWULBKHBX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|