C12H14O5 — CID 134657621
2-hydroxy-2-[3-methoxy-5-(3-oxopropyl)phenyl]acetic acid (PubChem CID 134657621) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-hydroxy-2-[3-methoxy-5-(3-oxopropyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-methoxy-5-(3-oxopropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134657621 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-hydroxy-2-[3-methoxy-5-(3-oxopropyl)phenyl]acetic acid |
| SMILES | COc1cc(CCC=O)cc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H14O5/c1-17-10-6-8(3-2-4-13)5-9(7-10)11(14)12(15)16/h4-7,11,14H,2-3H2,1H3,(H,15,16) |
| InChIKey | NVJWQNGSRIBUQI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|