C12H11F3O5 — CID 135741040
2-hydroxy-2-[3-(3-oxopropyl)-5-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 135741040) has the molecular formula C12H11F3O5 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(3-oxopropyl)-5-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[3-(3-oxopropyl)-5-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 135741040 |
| Molecular Formula | C12H11F3O5 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-hydroxy-2-[3-(3-oxopropyl)-5-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=CCCc1cc(OC(F)(F)F)cc(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H11F3O5/c13-12(14,15)20-9-5-7(2-1-3-16)4-8(6-9)10(17)11(18)19/h3-6,10,17H,1-2H2,(H,18,19) |
| InChIKey | TWCZXLDORZNEGQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|