C9H6BrF3N2O2 — CID 134659144
2-[4-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile (PubChem CID 134659144) has the molecular formula C9H6BrF3N2O2 and a molecular weight of 311.06 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134659144 |
| Molecular Formula | C9H6BrF3N2O2 |
| Molecular Weight | 311.06 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 2-[4-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(OC(F)(F)F)ncc(O)c1CBr |
| InChI | InChI=1S/C9H6BrF3N2O2/c10-3-6-5(1-2-14)8(15-4-7(6)16)17-9(11,12)13/h4,16H,1,3H2 |
| InChIKey | DFXBDUICOSCLOF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|