C10H9BrF3NO4 — CID 134664441
ethyl 3-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carboxylate (PubChem CID 134664441) has the molecular formula C10H9BrF3NO4 and a molecular weight of 344.08 g/mol. Its IUPAC name is ethyl 3-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carboxylate.
| Compound Name | ethyl 3-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134664441 |
| Molecular Formula | C10H9BrF3NO4 |
| Molecular Weight | 344.08 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | ethyl 3-(bromomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c(O)cnc(OC(F)(F)F)c1CBr |
| InChI | InChI=1S/C10H9BrF3NO4/c1-2-18-9(17)7-5(3-11)8(15-4-6(7)16)19-10(12,13)14/h4,16H,2-3H2,1H3 |
| InChIKey | CJXNFFWITJJUOQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|