C8H3F6NO3 — CID 134666235
2-oxo-5-(trifluoromethoxy)-3-(trifluoromethyl)-1H-pyridine-4-carbaldehyde (PubChem CID 134666235) has the molecular formula C8H3F6NO3 and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-oxo-5-(trifluoromethoxy)-3-(trifluoromethyl)-1H-pyridine-4-carbaldehyde.
| Compound Name | 2-oxo-5-(trifluoromethoxy)-3-(trifluoromethyl)-1H-pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 134666235 |
| Molecular Formula | C8H3F6NO3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-oxo-5-(trifluoromethoxy)-3-(trifluoromethyl)-1H-pyridine-4-carbaldehyde |
| SMILES | O=Cc1c(OC(F)(F)F)c[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C8H3F6NO3/c9-7(10,11)5-3(2-16)4(1-15-6(5)17)18-8(12,13)14/h1-2H,(H,15,17) |
| InChIKey | ZQNGYUQZKORANV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|