C8H7F3N2O3 — CID 134666990
3-(aminomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carbaldehyde (PubChem CID 134666990) has the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. Its IUPAC name is 3-(aminomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carbaldehyde.
| Compound Name | 3-(aminomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 134666990 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(aminomethyl)-5-hydroxy-2-(trifluoromethoxy)pyridine-4-carbaldehyde |
| SMILES | NCc1c(OC(F)(F)F)ncc(O)c1C=O |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)16-7-4(1-12)5(3-14)6(15)2-13-7/h2-3,15H,1,12H2 |
| InChIKey | FWBVDKRUTHQDCF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|