C17H33NO6SSi — CID 13467859
ethyl 3-ethoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilyloxythiolane-2-carboxylate (PubChem CID 13467859) has the molecular formula C17H33NO6SSi and a molecular weight of 407.61 g/mol. Its IUPAC name is ethyl 3-ethoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilyloxythiolane-2-carboxylate.
| Compound Name | ethyl 3-ethoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilyloxythiolane-2-carboxylate |
|---|---|
| PubChem CID | 13467859 |
| Molecular Formula | C17H33NO6SSi |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | ethyl 3-ethoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-trimethylsilyloxythiolane-2-carboxylate |
| SMILES | CCOC(=O)C1SCC(NC(=O)OC(C)(C)C)C1(OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H33NO6SSi/c1-9-21-14(19)13-17(22-10-2,24-26(6,7)8)12(11-25-13)18-15(20)23-16(3,4)5/h12-13H,9-11H2,1-8H3,(H,18,20) |
| InChIKey | YDOQOHQQHGVTPQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|