C12H21NO5S — CID 69237821
ethyl (2R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiolane-2-carboxylate (PubChem CID 69237821) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl (2R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiolane-2-carboxylate.
| Compound Name | ethyl (2R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiolane-2-carboxylate |
|---|---|
| PubChem CID | 69237821 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl (2R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]thiolane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1SCC(NC(=O)OC(C)(C)C)C1O |
| InChI | InChI=1S/C12H21NO5S/c1-5-17-10(15)9-8(14)7(6-19-9)13-11(16)18-12(2,3)4/h7-9,14H,5-6H2,1-4H3,(H,13,16)/t7?,8?,9-/m1/s1 |
| InChIKey | WHAXYCAWYPFDFO-AMDVSUOASA-N |
| XLogP | 0.92 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |