About ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate
ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 13468644) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate.
Analyze ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The IUPAC name of ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate (CID 13468644) is ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate is CCOC(=O)C1=C(C)OCCC1O.
What is the InChIKey of ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
The InChIKey is MSOWFURCXYERDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-3-12-9(11)8-6(2)13-5-4-7(8)10/h7,10H,3-5H2,1-2H3.
What are the key properties of ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate?
ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate has a molecular weight of 186.21 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-6-methyl-3,4-dihydro-2H-pyran-5-carboxylate is sourced from PubChem (CID 13468644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).