C15H25N5O2 — CID 134689540
1,1-dimethyl-3-[(3R)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]urea (PubChem CID 134689540) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(3R)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]urea.
| Compound Name | 1,1-dimethyl-3-[(3R)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]urea |
|---|---|
| PubChem CID | 134689540 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1,1-dimethyl-3-[(3R)-1-[(1-methylimidazol-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]urea |
| SMILES | CN(C)C(=O)N[C@@H]1CN(Cc2nccn2C)C2CCCOC21 |
| InChI | InChI=1S/C15H25N5O2/c1-18(2)15(21)17-11-9-20(10-13-16-6-7-19(13)3)12-5-4-8-22-14(11)12/h6-7,11-12,14H,4-5,8-10H2,1-3H3,(H,17,21)/t11-,12?,14?/m1/s1 |
| InChIKey | OFQAPFFZBHCUQR-LKSINWNRSA-N |
| XLogP | 0.42 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |