C25H30N2O6 — CID 134691615
3-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2-methyl-8-[(4-methylpiperazin-1-yl)methyl]chromen-4-one (PubChem CID 134691615) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2-methyl-8-[(4-methylpiperazin-1-yl)methyl]chromen-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2-methyl-8-[(4-methylpiperazin-1-yl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 134691615 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-6-methoxy-2-methyl-8-[(4-methylpiperazin-1-yl)methyl]chromen-4-one |
| SMILES | COc1ccc(-c2c(C)oc3c(CN4CCN(C)CC4)c(O)c(OC)cc3c2=O)cc1OC |
| InChI | InChI=1S/C25H30N2O6/c1-15-22(16-6-7-19(30-3)20(12-16)31-4)24(29)17-13-21(32-5)23(28)18(25(17)33-15)14-27-10-8-26(2)9-11-27/h6-7,12-13,28H,8-11,14H2,1-5H3 |
| InChIKey | IYYQKSBVWCWHLC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|