C29H30FNO2 — CID 134692319
9-(4-fluorophenyl)-3,3,6,6-tetramethyl-10-phenyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 134692319) has the molecular formula C29H30FNO2 and a molecular weight of 443.56 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3,3,6,6-tetramethyl-10-phenyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(4-fluorophenyl)-3,3,6,6-tetramethyl-10-phenyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 134692319 |
| Molecular Formula | C29H30FNO2 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 9-(4-fluorophenyl)-3,3,6,6-tetramethyl-10-phenyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccccc1)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(F)cc1 |
| InChI | InChI=1S/C29H30FNO2/c1-28(2)14-21-26(23(32)16-28)25(18-10-12-19(30)13-11-18)27-22(15-29(3,4)17-24(27)33)31(21)20-8-6-5-7-9-20/h5-13,25H,14-17H2,1-4H3 |
| InChIKey | HONYVBSORWYPCR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |