C5H8O4 — CID 134692637
(2Z)-2-(hydroxymethylidene)oxolane-3,4-diol (PubChem CID 134692637) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (2Z)-2-(hydroxymethylidene)oxolane-3,4-diol.
| Compound Name | (2Z)-2-(hydroxymethylidene)oxolane-3,4-diol |
|---|---|
| PubChem CID | 134692637 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2Z)-2-(hydroxymethylidene)oxolane-3,4-diol |
| SMILES | O/C=C1\OCC(O)C1O |
| InChI | InChI=1S/C5H8O4/c6-1-4-5(8)3(7)2-9-4/h1,3,5-8H,2H2/b4-1- |
| InChIKey | VYESUJXOGPEHNK-RJRFIUFISA-N |
| XLogP | -0.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|