C5H7O3U- — CID 58602404
(3S,4S)-5-methylidene-3,4-dihydro-2H-furan-2-ide-3,4-diol;uranium (PubChem CID 58602404) has the molecular formula C5H7O3U- and a molecular weight of 353.14 g/mol. Its IUPAC name is (3S,4S)-5-methylidene-3,4-dihydro-2H-furan-2-ide-3,4-diol;uranium.
| Compound Name | (3S,4S)-5-methylidene-3,4-dihydro-2H-furan-2-ide-3,4-diol;uranium |
|---|---|
| PubChem CID | 58602404 |
| Molecular Formula | C5H7O3U- |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (3S,4S)-5-methylidene-3,4-dihydro-2H-furan-2-ide-3,4-diol;uranium |
| SMILES | C=C1O[CH-][C@H](O)[C@@H]1O.[U] |
| InChI | InChI=1S/C5H7O3.U/c1-3-5(7)4(6)2-8-3;/h2,4-7H,1H2;/q-1;/t4-,5+;/m0./s1 |
| InChIKey | SATYSYCGZJIRNS-UYXJWNHNSA-N |
| XLogP | -0.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|